C26H25N5O2S — CID 4824578
2-[2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl]acetonitrile (PubChem CID 4824578) has the molecular formula C26H25N5O2S and a molecular weight of 471.59 g/mol. Its IUPAC name is 2-[2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl]acetonitrile.
| Compound Name | 2-[2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 4824578 |
| Molecular Formula | C26H25N5O2S |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 2-[2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl]acetonitrile |
| SMILES | COc1ccc(N2CCN(Cc3nc4scc(-c5ccccc5)c4c(=O)n3CC#N)CC2)cc1 |
| InChI | InChI=1S/C26H25N5O2S/c1-33-21-9-7-20(8-10-21)30-15-13-29(14-16-30)17-23-28-25-24(26(32)31(23)12-11-27)22(18-34-25)19-5-3-2-4-6-19/h2-10,18H,12-17H2,1H3 |
| InChIKey | HIZFYVCOQHIANF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 74.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|