C16H19F2N3O2 — CID 124838704
(2S,3aS,7aR)-1-N-(2,4-difluorophenyl)-2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxamide (PubChem CID 124838704) has the molecular formula C16H19F2N3O2 and a molecular weight of 323.34 g/mol. Its IUPAC name is (2S,3aS,7aR)-1-N-(2,4-difluorophenyl)-2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxamide.
| Compound Name | (2S,3aS,7aR)-1-N-(2,4-difluorophenyl)-2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxamide |
|---|---|
| PubChem CID | 124838704 |
| Molecular Formula | C16H19F2N3O2 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (2S,3aS,7aR)-1-N-(2,4-difluorophenyl)-2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxamide |
| SMILES | NC(=O)[C@@H]1C[C@@H]2CCCC[C@H]2N1C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C16H19F2N3O2/c17-10-5-6-12(11(18)8-10)20-16(23)21-13-4-2-1-3-9(13)7-14(21)15(19)22/h5-6,8-9,13-14H,1-4,7H2,(H2,19,22)(H,20,23)/t9-,13+,14-/m0/s1 |
| InChIKey | BBPXYAVJJFMBEZ-FZZIBODNSA-N |
| XLogP | 2.62 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |