C22H33N3O6 — CID 124840458
tert-butyl N-[[(3R)-1-[2-[(3aS,4R,7R,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]acetyl]piperidin-3-yl]methyl]-N-methylcarbamate (PubChem CID 124840458) has the molecular formula C22H33N3O6 and a molecular weight of 435.52 g/mol. Its IUPAC name is tert-butyl N-[[(3R)-1-[2-[(3aS,4R,7R,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]acetyl]piperidin-3-yl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[(3R)-1-[2-[(3aS,4R,7R,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]acetyl]piperidin-3-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 124840458 |
| Molecular Formula | C22H33N3O6 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | tert-butyl N-[[(3R)-1-[2-[(3aS,4R,7R,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]acetyl]piperidin-3-yl]methyl]-N-methylcarbamate |
| SMILES | CN(C[C@@H]1CCCN(C(=O)CN2C(=O)[C@H]3[C@H](C2=O)[C@H]2CC[C@H]3O2)C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H33N3O6/c1-22(2,3)31-21(29)23(4)10-13-6-5-9-24(11-13)16(26)12-25-19(27)17-14-7-8-15(30-14)18(17)20(25)28/h13-15,17-18H,5-12H2,1-4H3/t13-,14+,15+,17+,18+/m0/s1 |
| InChIKey | CQDACPNKCUZPBG-DBXHJTGRSA-N |
| XLogP | 1.25 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|