C15H22ClN3O2S — CID 124843699
1-[4-(5-chlorothiophen-2-yl)butyl]-3-[(3R)-1-methyl-6-oxopiperidin-3-yl]urea (PubChem CID 124843699) has the molecular formula C15H22ClN3O2S and a molecular weight of 343.88 g/mol. Its IUPAC name is 1-[4-(5-chlorothiophen-2-yl)butyl]-3-[(3R)-1-methyl-6-oxopiperidin-3-yl]urea.
| Compound Name | 1-[4-(5-chlorothiophen-2-yl)butyl]-3-[(3R)-1-methyl-6-oxopiperidin-3-yl]urea |
|---|---|
| PubChem CID | 124843699 |
| Molecular Formula | C15H22ClN3O2S |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-[4-(5-chlorothiophen-2-yl)butyl]-3-[(3R)-1-methyl-6-oxopiperidin-3-yl]urea |
| SMILES | CN1C[C@H](NC(=O)NCCCCc2ccc(Cl)s2)CCC1=O |
| InChI | InChI=1S/C15H22ClN3O2S/c1-19-10-11(5-8-14(19)20)18-15(21)17-9-3-2-4-12-6-7-13(16)22-12/h6-7,11H,2-5,8-10H2,1H3,(H2,17,18,21)/t11-/m1/s1 |
| InChIKey | FCABIFDYXIEHBK-LLVKDONJSA-N |
| XLogP | 2.64 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|