C17H21N3O — CID 124844620
(5S)-3-ethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-4,5-dihydro-1,2-oxazole (PubChem CID 124844620) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is (5S)-3-ethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-4,5-dihydro-1,2-oxazole.
| Compound Name | (5S)-3-ethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 124844620 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | (5S)-3-ethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-4,5-dihydro-1,2-oxazole |
| SMILES | CCC1=NO[C@H](CN2CCc3c([nH]c4ccccc34)C2)C1 |
| InChI | InChI=1S/C17H21N3O/c1-2-12-9-13(21-19-12)10-20-8-7-15-14-5-3-4-6-16(14)18-17(15)11-20/h3-6,13,18H,2,7-11H2,1H3/t13-/m0/s1 |
| InChIKey | GNQMMVULEANXPZ-ZDUSSCGKSA-N |
| XLogP | 3.08 |
| TPSA | 40.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|