C15H24N4 — CID 124845430
(1R,2R,6S,7S,8R)-N-[(2R)-1-(1,2,4-triazol-1-yl)propan-2-yl]tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 124845430) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is (1R,2R,6S,7S,8R)-N-[(2R)-1-(1,2,4-triazol-1-yl)propan-2-yl]tricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | (1R,2R,6S,7S,8R)-N-[(2R)-1-(1,2,4-triazol-1-yl)propan-2-yl]tricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 124845430 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | (1R,2R,6S,7S,8R)-N-[(2R)-1-(1,2,4-triazol-1-yl)propan-2-yl]tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | C[C@H](Cn1cncn1)N[C@@H]1C[C@H]2C[C@H]1[C@H]1CCC[C@H]21 |
| InChI | InChI=1S/C15H24N4/c1-10(7-19-9-16-8-17-19)18-15-6-11-5-14(15)13-4-2-3-12(11)13/h8-15,18H,2-7H2,1H3/t10-,11-,12-,13+,14+,15-/m1/s1 |
| InChIKey | MIJXVSULAXYUMA-PMXAPFLYSA-N |
| XLogP | 2.08 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |