C14H18ClNO5S — CID 124849645
methyl (2R,3R)-3-[(4-chloro-2-methylbenzoyl)sulfamoyl]-2-methylbutanoate (PubChem CID 124849645) has the molecular formula C14H18ClNO5S and a molecular weight of 347.82 g/mol. Its IUPAC name is methyl (2R,3R)-3-[(4-chloro-2-methylbenzoyl)sulfamoyl]-2-methylbutanoate.
| Compound Name | methyl (2R,3R)-3-[(4-chloro-2-methylbenzoyl)sulfamoyl]-2-methylbutanoate |
|---|---|
| PubChem CID | 124849645 |
| Molecular Formula | C14H18ClNO5S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | methyl (2R,3R)-3-[(4-chloro-2-methylbenzoyl)sulfamoyl]-2-methylbutanoate |
| SMILES | COC(=O)[C@@H](C)[C@@H](C)S(=O)(=O)NC(=O)c1ccc(Cl)cc1C |
| InChI | InChI=1S/C14H18ClNO5S/c1-8-7-11(15)5-6-12(8)13(17)16-22(19,20)10(3)9(2)14(18)21-4/h5-7,9-10H,1-4H3,(H,16,17)/t9-,10+/m0/s1 |
| InChIKey | PDUGPJCAQJKSHS-VHSXEESVSA-N |
| XLogP | 1.91 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |