C15H12ClNO5S — CID 10020985
N-(1,3-benzodioxol-5-ylsulfonyl)-4-chloro-2-methylbenzamide (PubChem CID 10020985) has the molecular formula C15H12ClNO5S and a molecular weight of 353.78 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylsulfonyl)-4-chloro-2-methylbenzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylsulfonyl)-4-chloro-2-methylbenzamide |
|---|---|
| PubChem CID | 10020985 |
| Molecular Formula | C15H12ClNO5S |
| Molecular Weight | 353.78 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylsulfonyl)-4-chloro-2-methylbenzamide |
| SMILES | Cc1cc(Cl)ccc1C(=O)NS(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H12ClNO5S/c1-9-6-10(16)2-4-12(9)15(18)17-23(19,20)11-3-5-13-14(7-11)22-8-21-13/h2-7H,8H2,1H3,(H,17,18) |
| InChIKey | BQDOZDOLTYCBOP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.78 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |