C17H22N2O4S — CID 124855022
N-[(3S)-1,1-dioxothiolan-3-yl]-2-(1-propan-2-ylindol-4-yl)oxyacetamide (PubChem CID 124855022) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-(1-propan-2-ylindol-4-yl)oxyacetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(1-propan-2-ylindol-4-yl)oxyacetamide |
|---|---|
| PubChem CID | 124855022 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(1-propan-2-ylindol-4-yl)oxyacetamide |
| SMILES | CC(C)n1ccc2c(OCC(=O)N[C@H]3CCS(=O)(=O)C3)cccc21 |
| InChI | InChI=1S/C17H22N2O4S/c1-12(2)19-8-6-14-15(19)4-3-5-16(14)23-10-17(20)18-13-7-9-24(21,22)11-13/h3-6,8,12-13H,7,9-11H2,1-2H3,(H,18,20)/t13-/m0/s1 |
| InChIKey | YKEKSOXKYJDBTM-ZDUSSCGKSA-N |
| XLogP | 1.90 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |