C18H24N2O4S — CID 91822129
N-(1,1-dioxothiolan-3-yl)-2-[1-(2-methylpropyl)indol-4-yl]oxyacetamide (PubChem CID 91822129) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-[1-(2-methylpropyl)indol-4-yl]oxyacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-[1-(2-methylpropyl)indol-4-yl]oxyacetamide |
|---|---|
| PubChem CID | 91822129 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-[1-(2-methylpropyl)indol-4-yl]oxyacetamide |
| SMILES | CC(C)Cn1ccc2c(OCC(=O)NC3CCS(=O)(=O)C3)cccc21 |
| InChI | InChI=1S/C18H24N2O4S/c1-13(2)10-20-8-6-15-16(20)4-3-5-17(15)24-11-18(21)19-14-7-9-25(22,23)12-14/h3-6,8,13-14H,7,9-12H2,1-2H3,(H,19,21) |
| InChIKey | PVBLMQGDARZKDO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |