C15H19N3O5S2 — CID 86207176
N-(1,1-dioxothiolan-3-yl)-2-[4-(methanesulfonamido)indol-1-yl]acetamide (PubChem CID 86207176) has the molecular formula C15H19N3O5S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-[4-(methanesulfonamido)indol-1-yl]acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-[4-(methanesulfonamido)indol-1-yl]acetamide |
|---|---|
| PubChem CID | 86207176 |
| Molecular Formula | C15H19N3O5S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-[4-(methanesulfonamido)indol-1-yl]acetamide |
| SMILES | CS(=O)(=O)Nc1cccc2c1ccn2CC(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H19N3O5S2/c1-24(20,21)17-13-3-2-4-14-12(13)5-7-18(14)9-15(19)16-11-6-8-25(22,23)10-11/h2-5,7,11,17H,6,8-10H2,1H3,(H,16,19) |
| InChIKey | KRSKRNCKUQYFGX-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |