C15H25N3O4S — CID 124865779
(2S)-2-(furan-2-yl)-N-[(2R)-2-morpholin-4-ylpropyl]pyrrolidine-1-sulfonamide (PubChem CID 124865779) has the molecular formula C15H25N3O4S and a molecular weight of 343.45 g/mol. Its IUPAC name is (2S)-2-(furan-2-yl)-N-[(2R)-2-morpholin-4-ylpropyl]pyrrolidine-1-sulfonamide.
| Compound Name | (2S)-2-(furan-2-yl)-N-[(2R)-2-morpholin-4-ylpropyl]pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 124865779 |
| Molecular Formula | C15H25N3O4S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (2S)-2-(furan-2-yl)-N-[(2R)-2-morpholin-4-ylpropyl]pyrrolidine-1-sulfonamide |
| SMILES | C[C@H](CNS(=O)(=O)N1CCC[C@H]1c1ccco1)N1CCOCC1 |
| InChI | InChI=1S/C15H25N3O4S/c1-13(17-7-10-21-11-8-17)12-16-23(19,20)18-6-2-4-14(18)15-5-3-9-22-15/h3,5,9,13-14,16H,2,4,6-8,10-12H2,1H3/t13-,14+/m1/s1 |
| InChIKey | DMFNKJSNGNSQKU-KGLIPLIRSA-N |
| XLogP | 0.97 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |