C13H18N6O3S — CID 71872996
N-[(1-cyclopropyltetrazol-5-yl)methyl]-2-(furan-2-yl)pyrrolidine-1-sulfonamide (PubChem CID 71872996) has the molecular formula C13H18N6O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is N-[(1-cyclopropyltetrazol-5-yl)methyl]-2-(furan-2-yl)pyrrolidine-1-sulfonamide.
| Compound Name | N-[(1-cyclopropyltetrazol-5-yl)methyl]-2-(furan-2-yl)pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 71872996 |
| Molecular Formula | C13H18N6O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-[(1-cyclopropyltetrazol-5-yl)methyl]-2-(furan-2-yl)pyrrolidine-1-sulfonamide |
| SMILES | O=S(=O)(NCc1nnnn1C1CC1)N1CCCC1c1ccco1 |
| InChI | InChI=1S/C13H18N6O3S/c20-23(21,14-9-13-15-16-17-19(13)10-5-6-10)18-7-1-3-11(18)12-4-2-8-22-12/h2,4,8,10-11,14H,1,3,5-7,9H2 |
| InChIKey | QHYPDGWGBSORKO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |