C17H22FNO3 — CID 124881517
(2R)-1-[[(1S)-1-(4-fluoro-3-methoxyphenyl)ethyl]amino]-2-(5-methylfuran-2-yl)propan-2-ol (PubChem CID 124881517) has the molecular formula C17H22FNO3 and a molecular weight of 307.37 g/mol. Its IUPAC name is (2R)-1-[[(1S)-1-(4-fluoro-3-methoxyphenyl)ethyl]amino]-2-(5-methylfuran-2-yl)propan-2-ol.
| Compound Name | (2R)-1-[[(1S)-1-(4-fluoro-3-methoxyphenyl)ethyl]amino]-2-(5-methylfuran-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 124881517 |
| Molecular Formula | C17H22FNO3 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (2R)-1-[[(1S)-1-(4-fluoro-3-methoxyphenyl)ethyl]amino]-2-(5-methylfuran-2-yl)propan-2-ol |
| SMILES | COc1cc([C@H](C)NC[C@@](C)(O)c2ccc(C)o2)ccc1F |
| InChI | InChI=1S/C17H22FNO3/c1-11-5-8-16(22-11)17(3,20)10-19-12(2)13-6-7-14(18)15(9-13)21-4/h5-9,12,19-20H,10H2,1-4H3/t12-,17+/m0/s1 |
| InChIKey | XIJDQQWNWWUYGH-YVEFUNNKSA-N |
| XLogP | 3.29 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |