About methyl 2-[[(4S)-4-methyl-4,5-dihydro-1,3-thiazol-2-yl]sulfanylmethyl]benzoate
methyl 2-[[(4S)-4-methyl-4,5-dihydro-1,3-thiazol-2-yl]sulfanylmethyl]benzoate (PubChem CID 124881721) has the molecular formula C13H15NO2S2
and a molecular weight of 281.40 g/mol. Its IUPAC name is methyl 2-[[(4S)-4-methyl-4,5-dihydro-1,3-thiazol-2-yl]sulfanylmethyl]benzoate.
Molecular Properties
| Compound Name | methyl 2-[[(4S)-4-methyl-4,5-dihydro-1,3-thiazol-2-yl]sulfanylmethyl]benzoate |
| PubChem CID | 124881721 |
| Molecular Formula | C13H15NO2S2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | methyl 2-[[(4S)-4-methyl-4,5-dihydro-1,3-thiazol-2-yl]sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccccc1CSC1=N[C@@H](C)CS1 |
| InChI | InChI=1S/C13H15NO2S2/c1-9-7-17-13(14-9)18-8-10-5-3-4-6-11(10)12(15)16-2/h3-6,9H,7-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | ASVBLYUEOQXEGN-VIFPVBQESA-N |
| XLogP | 3.20 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[[(4S)-4-methyl-4,5-dihydro-1,3-thiazol-2-yl]sulfanylmethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(4S)-4-methyl-4,5-dihydro-1,3-thiazol-2-yl]sulfanylmethyl]benzoate?
The IUPAC name of methyl 2-[[(4S)-4-methyl-4,5-dihydro-1,3-thiazol-2-yl]sulfanylmethyl]benzoate (CID 124881721) is methyl 2-[[(4S)-4-methyl-4,5-dihydro-1,3-thiazol-2-yl]sulfanylmethyl]benzoate.
What is the SMILES notation for methyl 2-[[(4S)-4-methyl-4,5-dihydro-1,3-thiazol-2-yl]sulfanylmethyl]benzoate?
The canonical SMILES for methyl 2-[[(4S)-4-methyl-4,5-dihydro-1,3-thiazol-2-yl]sulfanylmethyl]benzoate is COC(=O)c1ccccc1CSC1=N[C@@H](C)CS1.
What is the InChIKey of methyl 2-[[(4S)-4-methyl-4,5-dihydro-1,3-thiazol-2-yl]sulfanylmethyl]benzoate?
The InChIKey is ASVBLYUEOQXEGN-VIFPVBQESA-N. The full InChI is InChI=1S/C13H15NO2S2/c1-9-7-17-13(14-9)18-8-10-5-3-4-6-11(10)12(15)16-2/h3-6,9H,7-8H2,1-2H3/t9-/m0/s1.
What are the key properties of methyl 2-[[(4S)-4-methyl-4,5-dihydro-1,3-thiazol-2-yl]sulfanylmethyl]benzoate?
methyl 2-[[(4S)-4-methyl-4,5-dihydro-1,3-thiazol-2-yl]sulfanylmethyl]benzoate has a molecular weight of 281.40 g/mol, XLogP of 3.20, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(4S)-4-methyl-4,5-dihydro-1,3-thiazol-2-yl]sulfanylmethyl]benzoate is sourced from PubChem (CID 124881721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).