C12H11F2N5O — CID 124882455
trans-(1S,2S)-2-(2,6-difluorophenyl)-N'-(1H-1,2,4-triazol-5-yl)cyclopropane-1-carbohydrazide (PubChem CID 124882455) has the molecular formula C12H11F2N5O and a molecular weight of 279.25 g/mol. Its IUPAC name is trans-(1S,2S)-2-(2,6-difluorophenyl)-N'-(1H-1,2,4-triazol-5-yl)cyclopropane-1-carbohydrazide.
| Compound Name | trans-(1S,2S)-2-(2,6-difluorophenyl)-N'-(1H-1,2,4-triazol-5-yl)cyclopropane-1-carbohydrazide |
|---|---|
| PubChem CID | 124882455 |
| Molecular Formula | C12H11F2N5O |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | trans-(1S,2S)-2-(2,6-difluorophenyl)-N'-(1H-1,2,4-triazol-5-yl)cyclopropane-1-carbohydrazide |
| SMILES | O=C(NNc1ncn[nH]1)[C@H]1C[C@@H]1c1c(F)cccc1F |
| InChI | InChI=1S/C12H11F2N5O/c13-8-2-1-3-9(14)10(8)6-4-7(6)11(20)17-19-12-15-5-16-18-12/h1-3,5-7H,4H2,(H,17,20)(H2,15,16,18,19)/t6-,7-/m0/s1 |
| InChIKey | GNQJCNCEKOCRLY-BQBZGAKWSA-N |
| XLogP | 1.33 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|