C15H14F2N4O2 — CID 99632159
trans-(1R,2R)-2-(2,6-difluorophenyl)-N'-(3-methoxypyrazin-2-yl)cyclopropane-1-carbohydrazide (PubChem CID 99632159) has the molecular formula C15H14F2N4O2 and a molecular weight of 320.30 g/mol. Its IUPAC name is trans-(1R,2R)-2-(2,6-difluorophenyl)-N'-(3-methoxypyrazin-2-yl)cyclopropane-1-carbohydrazide.
| Compound Name | trans-(1R,2R)-2-(2,6-difluorophenyl)-N'-(3-methoxypyrazin-2-yl)cyclopropane-1-carbohydrazide |
|---|---|
| PubChem CID | 99632159 |
| Molecular Formula | C15H14F2N4O2 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | trans-(1R,2R)-2-(2,6-difluorophenyl)-N'-(3-methoxypyrazin-2-yl)cyclopropane-1-carbohydrazide |
| SMILES | COc1nccnc1NNC(=O)[C@@H]1C[C@H]1c1c(F)cccc1F |
| InChI | InChI=1S/C15H14F2N4O2/c1-23-15-13(18-5-6-19-15)20-21-14(22)9-7-8(9)12-10(16)3-2-4-11(12)17/h2-6,8-9H,7H2,1H3,(H,18,20)(H,21,22)/t8-,9-/m1/s1 |
| InChIKey | YSTQBHVNJHGMOZ-RKDXNWHRSA-N |
| XLogP | 2.01 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|