C18H21F2N3O2 — CID 124883388
N-[(1R,2S)-1-(2,6-difluorophenyl)-1-hydroxybutan-2-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 124883388) has the molecular formula C18H21F2N3O2 and a molecular weight of 349.38 g/mol. Its IUPAC name is N-[(1R,2S)-1-(2,6-difluorophenyl)-1-hydroxybutan-2-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-[(1R,2S)-1-(2,6-difluorophenyl)-1-hydroxybutan-2-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 124883388 |
| Molecular Formula | C18H21F2N3O2 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N-[(1R,2S)-1-(2,6-difluorophenyl)-1-hydroxybutan-2-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | CC[C@H](NC(=O)c1cnn2c1CCCC2)[C@H](O)c1c(F)cccc1F |
| InChI | InChI=1S/C18H21F2N3O2/c1-2-14(17(24)16-12(19)6-5-7-13(16)20)22-18(25)11-10-21-23-9-4-3-8-15(11)23/h5-7,10,14,17,24H,2-4,8-9H2,1H3,(H,22,25)/t14-,17-/m0/s1 |
| InChIKey | DYKOWKVBUCZBPE-YOEHRIQHSA-N |
| XLogP | 2.74 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |