C14H14FN3O2 — CID 86787157
N-(2-fluoro-4-hydroxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 86787157) has the molecular formula C14H14FN3O2 and a molecular weight of 275.28 g/mol. Its IUPAC name is N-(2-fluoro-4-hydroxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-(2-fluoro-4-hydroxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 86787157 |
| Molecular Formula | C14H14FN3O2 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N-(2-fluoro-4-hydroxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1F)c1cnn2c1CCCC2 |
| InChI | InChI=1S/C14H14FN3O2/c15-11-7-9(19)4-5-12(11)17-14(20)10-8-16-18-6-2-1-3-13(10)18/h4-5,7-8,19H,1-3,6H2,(H,17,20) |
| InChIKey | CCFIXKNJVQTBSJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|