C15H16N2O4S — CID 124885069
8-methyl-N-[(3S,5S)-5-methyl-2-oxooxolan-3-yl]quinoline-5-sulfonamide (PubChem CID 124885069) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is 8-methyl-N-[(3S,5S)-5-methyl-2-oxooxolan-3-yl]quinoline-5-sulfonamide.
| Compound Name | 8-methyl-N-[(3S,5S)-5-methyl-2-oxooxolan-3-yl]quinoline-5-sulfonamide |
|---|---|
| PubChem CID | 124885069 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 8-methyl-N-[(3S,5S)-5-methyl-2-oxooxolan-3-yl]quinoline-5-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H]2C[C@H](C)OC2=O)c2cccnc12 |
| InChI | InChI=1S/C15H16N2O4S/c1-9-5-6-13(11-4-3-7-16-14(9)11)22(19,20)17-12-8-10(2)21-15(12)18/h3-7,10,12,17H,8H2,1-2H3/t10-,12-/m0/s1 |
| InChIKey | GMVZFCMIDFSUQT-JQWIXIFHSA-N |
| XLogP | 1.53 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |