C20H25N5O3 — CID 124886577
2-[[(1S,2R)-2-cyanocyclopentyl]amino]-N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetamide (PubChem CID 124886577) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-[[(1S,2R)-2-cyanocyclopentyl]amino]-N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetamide.
| Compound Name | 2-[[(1S,2R)-2-cyanocyclopentyl]amino]-N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 124886577 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 2-[[(1S,2R)-2-cyanocyclopentyl]amino]-N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetamide |
| SMILES | C[C@]1(CCc2ccccc2)NC(=O)N(NC(=O)CN[C@H]2CCC[C@H]2C#N)C1=O |
| InChI | InChI=1S/C20H25N5O3/c1-20(11-10-14-6-3-2-4-7-14)18(27)25(19(28)23-20)24-17(26)13-22-16-9-5-8-15(16)12-21/h2-4,6-7,15-16,22H,5,8-11,13H2,1H3,(H,23,28)(H,24,26)/t15-,16-,20+/m0/s1 |
| InChIKey | HDFGDDQZNCSJPV-TWOQFEAHSA-N |
| XLogP | 1.24 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|