C18H22ClN3O5S — CID 124887641
4-[(2R)-4-(2-chlorophenyl)sulfonylmorpholine-2-carbonyl]-1-cyclopropylpiperazin-2-one (PubChem CID 124887641) has the molecular formula C18H22ClN3O5S and a molecular weight of 427.91 g/mol. Its IUPAC name is 4-[(2R)-4-(2-chlorophenyl)sulfonylmorpholine-2-carbonyl]-1-cyclopropylpiperazin-2-one.
| Compound Name | 4-[(2R)-4-(2-chlorophenyl)sulfonylmorpholine-2-carbonyl]-1-cyclopropylpiperazin-2-one |
|---|---|
| PubChem CID | 124887641 |
| Molecular Formula | C18H22ClN3O5S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 4-[(2R)-4-(2-chlorophenyl)sulfonylmorpholine-2-carbonyl]-1-cyclopropylpiperazin-2-one |
| SMILES | O=C([C@H]1CN(S(=O)(=O)c2ccccc2Cl)CCO1)N1CCN(C2CC2)C(=O)C1 |
| InChI | InChI=1S/C18H22ClN3O5S/c19-14-3-1-2-4-16(14)28(25,26)21-9-10-27-15(11-21)18(24)20-7-8-22(13-5-6-13)17(23)12-20/h1-4,13,15H,5-12H2/t15-/m1/s1 |
| InChIKey | SXIOWIGZROYGCI-OAHLLOKOSA-N |
| XLogP | 0.56 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |