C20H22N2O3 — CID 124888574
3-[(3R)-1-acetyl-2,3-dihydroindol-3-yl]-N-(2-hydroxy-5-methylphenyl)propanamide (PubChem CID 124888574) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-[(3R)-1-acetyl-2,3-dihydroindol-3-yl]-N-(2-hydroxy-5-methylphenyl)propanamide.
| Compound Name | 3-[(3R)-1-acetyl-2,3-dihydroindol-3-yl]-N-(2-hydroxy-5-methylphenyl)propanamide |
|---|---|
| PubChem CID | 124888574 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 3-[(3R)-1-acetyl-2,3-dihydroindol-3-yl]-N-(2-hydroxy-5-methylphenyl)propanamide |
| SMILES | CC(=O)N1C[C@H](CCC(=O)Nc2cc(C)ccc2O)c2ccccc21 |
| InChI | InChI=1S/C20H22N2O3/c1-13-7-9-19(24)17(11-13)21-20(25)10-8-15-12-22(14(2)23)18-6-4-3-5-16(15)18/h3-7,9,11,15,24H,8,10,12H2,1-2H3,(H,21,25)/t15-/m0/s1 |
| InChIKey | KVFMERADIWRPRU-HNNXBMFYSA-N |
| XLogP | 3.57 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|