C16H21N3O — CID 124888922
(2R)-N-prop-2-enyl-2-(5-pyridin-3-yl-3,6-dihydro-2H-pyridin-1-yl)propanamide (PubChem CID 124888922) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is (2R)-N-prop-2-enyl-2-(5-pyridin-3-yl-3,6-dihydro-2H-pyridin-1-yl)propanamide.
| Compound Name | (2R)-N-prop-2-enyl-2-(5-pyridin-3-yl-3,6-dihydro-2H-pyridin-1-yl)propanamide |
|---|---|
| PubChem CID | 124888922 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | (2R)-N-prop-2-enyl-2-(5-pyridin-3-yl-3,6-dihydro-2H-pyridin-1-yl)propanamide |
| SMILES | C=CCNC(=O)[C@@H](C)N1CCC=C(c2cccnc2)C1 |
| InChI | InChI=1S/C16H21N3O/c1-3-8-18-16(20)13(2)19-10-5-7-15(12-19)14-6-4-9-17-11-14/h3-4,6-7,9,11,13H,1,5,8,10,12H2,2H3,(H,18,20)/t13-/m1/s1 |
| InChIKey | UFXJGFWZTQIAMB-CYBMUJFWSA-N |
| XLogP | 1.86 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|