C14H13N3O3 — CID 67108929
1-(2-oxo-6-pyridin-3-ylpyran-3-yl)-3-prop-2-enylurea (PubChem CID 67108929) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is 1-(2-oxo-6-pyridin-3-ylpyran-3-yl)-3-prop-2-enylurea.
| Compound Name | 1-(2-oxo-6-pyridin-3-ylpyran-3-yl)-3-prop-2-enylurea |
|---|---|
| PubChem CID | 67108929 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1-(2-oxo-6-pyridin-3-ylpyran-3-yl)-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)Nc1ccc(-c2cccnc2)oc1=O |
| InChI | InChI=1S/C14H13N3O3/c1-2-7-16-14(19)17-11-5-6-12(20-13(11)18)10-4-3-8-15-9-10/h2-6,8-9H,1,7H2,(H2,16,17,19) |
| InChIKey | UXQWPQHHYCSSOM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|