C19H25N3O2 — CID 124890560
(7aR)-2-[(2R,4S)-1-benzyl-2-methylpiperidin-4-yl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 124890560) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is (7aR)-2-[(2R,4S)-1-benzyl-2-methylpiperidin-4-yl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | (7aR)-2-[(2R,4S)-1-benzyl-2-methylpiperidin-4-yl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 124890560 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | (7aR)-2-[(2R,4S)-1-benzyl-2-methylpiperidin-4-yl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | C[C@@H]1C[C@@H](N2C(=O)[C@H]3CCCN3C2=O)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C19H25N3O2/c1-14-12-16(9-11-20(14)13-15-6-3-2-4-7-15)22-18(23)17-8-5-10-21(17)19(22)24/h2-4,6-7,14,16-17H,5,8-13H2,1H3/t14-,16+,17-/m1/s1 |
| InChIKey | WKLKSXSJUWMMBS-HYVNUMGLSA-N |
| XLogP | 2.47 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|