C34H53NO4 — CID 124897520
[(1R,2R,4R,8R,9S,12R,13R,16S)-6-[(3S)-4-acetamido-3-methylbutyl]-4,7,9,13-tetramethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] butanoate (PubChem CID 124897520) has the molecular formula C34H53NO4 and a molecular weight of 539.80 g/mol. Its IUPAC name is [(1R,2R,4R,8R,9S,12R,13R,16S)-6-[(3S)-4-acetamido-3-methylbutyl]-4,7,9,13-tetramethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] butanoate.
| Compound Name | [(1R,2R,4R,8R,9S,12R,13R,16S)-6-[(3S)-4-acetamido-3-methylbutyl]-4,7,9,13-tetramethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] butanoate |
|---|---|
| PubChem CID | 124897520 |
| Molecular Formula | C34H53NO4 |
| Molecular Weight | 539.80 g/mol |
| Exact Mass | 539.40 |
| IUPAC Name | [(1R,2R,4R,8R,9S,12R,13R,16S)-6-[(3S)-4-acetamido-3-methylbutyl]-4,7,9,13-tetramethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@H]4C[C@@]5(C)OC(CC[C@H](C)CNC(C)=O)=C(C)[C@H]5[C@@]4(C)CC[C@H]32)C1 |
| InChI | InChI=1S/C34H53NO4/c1-8-9-30(37)38-25-14-16-32(5)24(18-25)11-12-26-27(32)15-17-33(6)28(26)19-34(7)31(33)22(3)29(39-34)13-10-21(2)20-35-23(4)36/h11,21,25-28,31H,8-10,12-20H2,1-7H3,(H,35,36)/t21-,25-,26-,27+,28+,31-,32-,33-,34+/m0/s1 |
| InChIKey | HWSROTCSZPVFBN-JSRJMZMPSA-N |
| XLogP | 7.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.80 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|