C32H49NO4 — CID 51690010
[(1R,2S,4S,8R,9S,12R,13R,16S)-6-[(3R)-4-acetamido-3-methylbutyl]-4,7,9,13-tetramethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] acetate (PubChem CID 51690010) has the molecular formula C32H49NO4 and a molecular weight of 511.75 g/mol. Its IUPAC name is [(1R,2S,4S,8R,9S,12R,13R,16S)-6-[(3R)-4-acetamido-3-methylbutyl]-4,7,9,13-tetramethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] acetate.
| Compound Name | [(1R,2S,4S,8R,9S,12R,13R,16S)-6-[(3R)-4-acetamido-3-methylbutyl]-4,7,9,13-tetramethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] acetate |
|---|---|
| PubChem CID | 51690010 |
| Molecular Formula | C32H49NO4 |
| Molecular Weight | 511.75 g/mol |
| Exact Mass | 511.37 |
| IUPAC Name | [(1R,2S,4S,8R,9S,12R,13R,16S)-6-[(3R)-4-acetamido-3-methylbutyl]-4,7,9,13-tetramethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] acetate |
| SMILES | CC(=O)NC[C@H](C)CCC1=C(C)[C@H]2[C@@]3(C)CC[C@@H]4[C@H](CC=C5C[C@@H](OC(C)=O)CC[C@@]54C)[C@@H]3C[C@]2(C)O1 |
| InChI | InChI=1S/C32H49NO4/c1-19(18-33-21(3)34)8-11-28-20(2)29-31(6)15-13-26-25(27(31)17-32(29,7)37-28)10-9-23-16-24(36-22(4)35)12-14-30(23,26)5/h9,19,24-27,29H,8,10-18H2,1-7H3,(H,33,34)/t19-,24+,25+,26-,27+,29+,30+,31+,32+/m1/s1 |
| InChIKey | FNGCXICTITYERH-VNJMABHJSA-N |
| XLogP | 6.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.75 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|