C33H51NO4 — CID 3651773
[6-(4-acetamido-3-methylbutyl)-4,7,9,13-tetramethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] propanoate (PubChem CID 3651773) has the molecular formula C33H51NO4 and a molecular weight of 525.77 g/mol. Its IUPAC name is [6-(4-acetamido-3-methylbutyl)-4,7,9,13-tetramethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] propanoate.
| Compound Name | [6-(4-acetamido-3-methylbutyl)-4,7,9,13-tetramethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] propanoate |
|---|---|
| PubChem CID | 3651773 |
| Molecular Formula | C33H51NO4 |
| Molecular Weight | 525.77 g/mol |
| Exact Mass | 525.38 |
| IUPAC Name | [6-(4-acetamido-3-methylbutyl)-4,7,9,13-tetramethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] propanoate |
| SMILES | CCC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C3CC3(C)OC(CCC(C)CNC(C)=O)=C(C)C32)C1 |
| InChI | InChI=1S/C33H51NO4/c1-8-29(36)37-24-13-15-31(5)23(17-24)10-11-25-26(31)14-16-32(6)27(25)18-33(7)30(32)21(3)28(38-33)12-9-20(2)19-34-22(4)35/h10,20,24-27,30H,8-9,11-19H2,1-7H3,(H,34,35) |
| InChIKey | HUHAAEUCEKEPLC-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.77 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|