C20H20N2O4 — CID 124907001
N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-1-oxo-2H-isoquinoline-4-carboxamide (PubChem CID 124907001) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-1-oxo-2H-isoquinoline-4-carboxamide.
| Compound Name | N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-1-oxo-2H-isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 124907001 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-1-oxo-2H-isoquinoline-4-carboxamide |
| SMILES | COc1ccc(OC)c([C@@H](C)NC(=O)c2c[nH]c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C20H20N2O4/c1-12(16-10-13(25-2)8-9-18(16)26-3)22-20(24)17-11-21-19(23)15-7-5-4-6-14(15)17/h4-12H,1-3H3,(H,21,23)(H,22,24)/t12-/m1/s1 |
| InChIKey | AEAROGWDTNZDNB-GFCCVEGCSA-N |
| XLogP | 3.04 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |