C18H19N3O3 — CID 17397509
N-[1-(2,5-dimethoxyphenyl)ethyl]-1H-indazole-3-carboxamide (PubChem CID 17397509) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[1-(2,5-dimethoxyphenyl)ethyl]-1H-indazole-3-carboxamide.
| Compound Name | N-[1-(2,5-dimethoxyphenyl)ethyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 17397509 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-[1-(2,5-dimethoxyphenyl)ethyl]-1H-indazole-3-carboxamide |
| SMILES | COc1ccc(OC)c(C(C)NC(=O)c2n[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C18H19N3O3/c1-11(14-10-12(23-2)8-9-16(14)24-3)19-18(22)17-13-6-4-5-7-15(13)20-21-17/h4-11H,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | WCXSFUHEQMCYHZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |