C14H16IN3O3 — CID 19479909
N-[1-(2,5-dimethoxyphenyl)ethyl]-4-iodo-1H-pyrazole-5-carboxamide (PubChem CID 19479909) has the molecular formula C14H16IN3O3 and a molecular weight of 401.20 g/mol. Its IUPAC name is N-[1-(2,5-dimethoxyphenyl)ethyl]-4-iodo-1H-pyrazole-5-carboxamide.
| Compound Name | N-[1-(2,5-dimethoxyphenyl)ethyl]-4-iodo-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19479909 |
| Molecular Formula | C14H16IN3O3 |
| Molecular Weight | 401.20 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | N-[1-(2,5-dimethoxyphenyl)ethyl]-4-iodo-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccc(OC)c(C(C)NC(=O)c2[nH]ncc2I)c1 |
| InChI | InChI=1S/C14H16IN3O3/c1-8(17-14(19)13-11(15)7-16-18-13)10-6-9(20-2)4-5-12(10)21-3/h4-8H,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | GTMZQQZAPDWRSV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|