C27H45NO — CID 124915879
(1S,2S,5S,6S,9R,10S,13S,16S)-5-methyl-6-[(2S)-6-methylheptan-2-yl]-17-oxa-18-azapentacyclo[14.3.1.01,13.02,10.05,9]icos-18-ene (PubChem CID 124915879) has the molecular formula C27H45NO and a molecular weight of 399.66 g/mol. Its IUPAC name is (1S,2S,5S,6S,9R,10S,13S,16S)-5-methyl-6-[(2S)-6-methylheptan-2-yl]-17-oxa-18-azapentacyclo[14.3.1.01,13.02,10.05,9]icos-18-ene.
| Compound Name | (1S,2S,5S,6S,9R,10S,13S,16S)-5-methyl-6-[(2S)-6-methylheptan-2-yl]-17-oxa-18-azapentacyclo[14.3.1.01,13.02,10.05,9]icos-18-ene |
|---|---|
| PubChem CID | 124915879 |
| Molecular Formula | C27H45NO |
| Molecular Weight | 399.66 g/mol |
| Exact Mass | 399.35 |
| IUPAC Name | (1S,2S,5S,6S,9R,10S,13S,16S)-5-methyl-6-[(2S)-6-methylheptan-2-yl]-17-oxa-18-azapentacyclo[14.3.1.01,13.02,10.05,9]icos-18-ene |
| SMILES | CC(C)CCC[C@H](C)[C@@H]1CC[C@@H]2[C@@H]3CC[C@H]4CC[C@H]5C[C@@]4(C=NO5)[C@H]3CC[C@]21C |
| InChI | InChI=1S/C27H45NO/c1-18(2)6-5-7-19(3)23-12-13-24-22-11-9-20-8-10-21-16-27(20,17-28-29-21)25(22)14-15-26(23,24)4/h17-25H,5-16H2,1-4H3/t19-,20+,21-,22-,23-,24+,25-,26-,27-/m0/s1 |
| InChIKey | HDHGWPLBZGZAAW-LBUIXAIHSA-N |
| XLogP | 7.47 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.66 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |