C20H36OSn — CID 124919059
tributyl-[2-[(1S,6S)-7-oxabicyclo[4.1.0]heptan-1-yl]ethynyl]stannane (PubChem CID 124919059) has the molecular formula C20H36OSn and a molecular weight of 411.22 g/mol. Its IUPAC name is tributyl-[2-[(1S,6S)-7-oxabicyclo[4.1.0]heptan-1-yl]ethynyl]stannane.
| Compound Name | tributyl-[2-[(1S,6S)-7-oxabicyclo[4.1.0]heptan-1-yl]ethynyl]stannane |
|---|---|
| PubChem CID | 124919059 |
| Molecular Formula | C20H36OSn |
| Molecular Weight | 411.22 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | tributyl-[2-[(1S,6S)-7-oxabicyclo[4.1.0]heptan-1-yl]ethynyl]stannane |
| SMILES | CCCC[Sn](C#C[C@@]12CCCC[C@@H]1O2)(CCCC)CCCC |
| InChI | InChI=1S/C8H9O.3C4H9.Sn/c1-2-8-6-4-3-5-7(8)9-8;3*1-3-4-2;/h7H,3-6H2;3*1,3-4H2,2H3;/t7-,8+;;;;/m0..../s1 |
| InChIKey | IMFHULXDNGKCHU-JWQBCWJNSA-N |
| XLogP | 6.09 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.22 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|