About tributyl(6-tributylstannylhexa-1,5-diynyl)stannane
tributyl(6-tributylstannylhexa-1,5-diynyl)stannane (PubChem CID 15733956) has the molecular formula C30H58Sn2
and a molecular weight of 656.22 g/mol. Its IUPAC name is tributyl(6-tributylstannylhexa-1,5-diynyl)stannane.
Molecular Properties
| Compound Name | tributyl(6-tributylstannylhexa-1,5-diynyl)stannane |
| PubChem CID | 15733956 |
| Molecular Formula | C30H58Sn2 |
| Molecular Weight | 656.22 g/mol |
| Exact Mass | 658.26 |
| IUPAC Name | tributyl(6-tributylstannylhexa-1,5-diynyl)stannane |
| SMILES | CCCC[Sn](C#CCCC#C[Sn](CCCC)(CCCC)CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C6H4.6C4H9.2Sn/c1-3-5-6-4-2;6*1-3-4-2;;/h5-6H2;6*1,3-4H2,2H3;; |
| InChIKey | OOKGFJIPTPBNLB-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 656.22 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tributyl(6-tributylstannylhexa-1,5-diynyl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl(6-tributylstannylhexa-1,5-diynyl)stannane?
The IUPAC name of tributyl(6-tributylstannylhexa-1,5-diynyl)stannane (CID 15733956) is tributyl(6-tributylstannylhexa-1,5-diynyl)stannane.
What is the SMILES notation for tributyl(6-tributylstannylhexa-1,5-diynyl)stannane?
The canonical SMILES for tributyl(6-tributylstannylhexa-1,5-diynyl)stannane is CCCC[Sn](C#CCCC#C[Sn](CCCC)(CCCC)CCCC)(CCCC)CCCC.
What is the InChIKey of tributyl(6-tributylstannylhexa-1,5-diynyl)stannane?
The InChIKey is OOKGFJIPTPBNLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4.6C4H9.2Sn/c1-3-5-6-4-2;6*1-3-4-2;;/h5-6H2;6*1,3-4H2,2H3;;.
What are the key properties of tributyl(6-tributylstannylhexa-1,5-diynyl)stannane?
tributyl(6-tributylstannylhexa-1,5-diynyl)stannane has a molecular weight of 656.22 g/mol, XLogP of 10.55, 19 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl(6-tributylstannylhexa-1,5-diynyl)stannane is sourced from PubChem (CID 15733956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).