C21H40OSn — CID 177468630
cis-(1R,2S)-2-(3-tributylstannylprop-2-ynyl)cyclohexan-1-ol (PubChem CID 177468630) has the molecular formula C21H40OSn and a molecular weight of 427.26 g/mol. Its IUPAC name is cis-(1R,2S)-2-(3-tributylstannylprop-2-ynyl)cyclohexan-1-ol.
| Compound Name | cis-(1R,2S)-2-(3-tributylstannylprop-2-ynyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 177468630 |
| Molecular Formula | C21H40OSn |
| Molecular Weight | 427.26 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | cis-(1R,2S)-2-(3-tributylstannylprop-2-ynyl)cyclohexan-1-ol |
| SMILES | CCCC[Sn](C#CC[C@@H]1CCCC[C@H]1O)(CCCC)CCCC |
| InChI | InChI=1S/C9H13O.3C4H9.Sn/c1-2-5-8-6-3-4-7-9(8)10;3*1-3-4-2;/h8-10H,3-7H2;3*1,3-4H2,2H3;/t8-,9-;;;;/m1..../s1 |
| InChIKey | KYSISUUHUXOBCB-WNHJFKIESA-N |
| XLogP | 6.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.26 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|