C22H40N2O4 — CID 124922659
[(1S,2R)-2-methylcyclohexyl] N-[6-[[(1S,2S)-2-methylcyclohexyl]oxycarbonylamino]hexyl]carbamate (PubChem CID 124922659) has the molecular formula C22H40N2O4 and a molecular weight of 396.57 g/mol. Its IUPAC name is [(1S,2R)-2-methylcyclohexyl] N-[6-[[(1S,2S)-2-methylcyclohexyl]oxycarbonylamino]hexyl]carbamate.
| Compound Name | [(1S,2R)-2-methylcyclohexyl] N-[6-[[(1S,2S)-2-methylcyclohexyl]oxycarbonylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 124922659 |
| Molecular Formula | C22H40N2O4 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | [(1S,2R)-2-methylcyclohexyl] N-[6-[[(1S,2S)-2-methylcyclohexyl]oxycarbonylamino]hexyl]carbamate |
| SMILES | C[C@@H]1CCCC[C@@H]1OC(=O)NCCCCCCNC(=O)O[C@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C22H40N2O4/c1-17-11-5-7-13-19(17)27-21(25)23-15-9-3-4-10-16-24-22(26)28-20-14-8-6-12-18(20)2/h17-20H,3-16H2,1-2H3,(H,23,25)(H,24,26)/t17-,18+,19-,20-/m0/s1 |
| InChIKey | GSDPJKQTOQPSIY-YRPNKDGESA-N |
| XLogP | 5.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|