C14H21NO7 — CID 124925604
(2,5-dioxocyclopentyl) (2S,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 124925604) has the molecular formula C14H21NO7 and a molecular weight of 315.32 g/mol. Its IUPAC name is (2,5-dioxocyclopentyl) (2S,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | (2,5-dioxocyclopentyl) (2S,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 124925604 |
| Molecular Formula | C14H21NO7 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (2,5-dioxocyclopentyl) (2S,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | C[C@@H](O)[C@H](NC(=O)OC(C)(C)C)C(=O)OC1C(=O)CCC1=O |
| InChI | InChI=1S/C14H21NO7/c1-7(16)10(15-13(20)22-14(2,3)4)12(19)21-11-8(17)5-6-9(11)18/h7,10-11,16H,5-6H2,1-4H3,(H,15,20)/t7-,10+/m1/s1 |
| InChIKey | BOJZLFANENSTQK-XCBNKYQSSA-N |
| XLogP | 0.10 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|