C30H40O6 — CID 124935525
[(3S,10S,13R,14S,17S)-6-acetyloxy-17-[(2S)-but-3-en-2-yl]-4,4,10,13,14-pentamethyl-7,11-dioxo-2,3,12,15,16,17-hexahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 124935525) has the molecular formula C30H40O6 and a molecular weight of 496.64 g/mol. Its IUPAC name is [(3S,10S,13R,14S,17S)-6-acetyloxy-17-[(2S)-but-3-en-2-yl]-4,4,10,13,14-pentamethyl-7,11-dioxo-2,3,12,15,16,17-hexahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,10S,13R,14S,17S)-6-acetyloxy-17-[(2S)-but-3-en-2-yl]-4,4,10,13,14-pentamethyl-7,11-dioxo-2,3,12,15,16,17-hexahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 124935525 |
| Molecular Formula | C30H40O6 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | [(3S,10S,13R,14S,17S)-6-acetyloxy-17-[(2S)-but-3-en-2-yl]-4,4,10,13,14-pentamethyl-7,11-dioxo-2,3,12,15,16,17-hexahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | C=C[C@H](C)[C@@H]1CC[C@]2(C)C3=C(C(=O)C[C@]12C)[C@@]1(C)CC[C@H](OC(C)=O)C(C)(C)C1=C(OC(C)=O)C3=O |
| InChI | InChI=1S/C30H40O6/c1-10-16(2)19-11-14-29(8)23-22(20(33)15-30(19,29)9)28(7)13-12-21(35-17(3)31)27(5,6)26(28)25(24(23)34)36-18(4)32/h10,16,19,21H,1,11-15H2,2-9H3/t16-,19-,21-,28+,29+,30+/m0/s1 |
| InChIKey | GYOCEEBUMQUZSK-WZAQWFDQSA-N |
| XLogP | 5.66 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|