C17H23ClO2 — CID 124941839
(1S,4R,5R,6S,7S)-4-(3-chlorophenyl)-2,2,6-trimethyl-3-oxabicyclo[3.3.1]nonan-7-ol (PubChem CID 124941839) has the molecular formula C17H23ClO2 and a molecular weight of 294.82 g/mol. Its IUPAC name is (1S,4R,5R,6S,7S)-4-(3-chlorophenyl)-2,2,6-trimethyl-3-oxabicyclo[3.3.1]nonan-7-ol.
| Compound Name | (1S,4R,5R,6S,7S)-4-(3-chlorophenyl)-2,2,6-trimethyl-3-oxabicyclo[3.3.1]nonan-7-ol |
|---|---|
| PubChem CID | 124941839 |
| Molecular Formula | C17H23ClO2 |
| Molecular Weight | 294.82 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (1S,4R,5R,6S,7S)-4-(3-chlorophenyl)-2,2,6-trimethyl-3-oxabicyclo[3.3.1]nonan-7-ol |
| SMILES | C[C@H]1[C@H]2C[C@@H](C[C@@H]1O)C(C)(C)O[C@H]2c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H23ClO2/c1-10-14-8-12(9-15(10)19)17(2,3)20-16(14)11-5-4-6-13(18)7-11/h4-7,10,12,14-16,19H,8-9H2,1-3H3/t10-,12-,14+,15-,16-/m0/s1 |
| InChIKey | AQGCMIBCUQQOOU-UHELNEPMSA-N |
| XLogP | 4.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.82 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |