C15H15N5O2 — CID 124945025
N-[(3R)-2-oxopiperidin-3-yl]-6-pyrimidin-5-ylpyridine-2-carboxamide (PubChem CID 124945025) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is N-[(3R)-2-oxopiperidin-3-yl]-6-pyrimidin-5-ylpyridine-2-carboxamide.
| Compound Name | N-[(3R)-2-oxopiperidin-3-yl]-6-pyrimidin-5-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 124945025 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-[(3R)-2-oxopiperidin-3-yl]-6-pyrimidin-5-ylpyridine-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCCNC1=O)c1cccc(-c2cncnc2)n1 |
| InChI | InChI=1S/C15H15N5O2/c21-14-12(5-2-6-18-14)20-15(22)13-4-1-3-11(19-13)10-7-16-9-17-8-10/h1,3-4,7-9,12H,2,5-6H2,(H,18,21)(H,20,22)/t12-/m1/s1 |
| InChIKey | BNVNXJCPVGKJJZ-GFCCVEGCSA-N |
| XLogP | 0.55 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |