C25H37NO4 — CID 124978838
N-[(1S,5S,6S,8R,10R)-5-(2,3-dimethoxyphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]-3-methylbutanamide (PubChem CID 124978838) has the molecular formula C25H37NO4 and a molecular weight of 415.57 g/mol. Its IUPAC name is N-[(1S,5S,6S,8R,10R)-5-(2,3-dimethoxyphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]-3-methylbutanamide.
| Compound Name | N-[(1S,5S,6S,8R,10R)-5-(2,3-dimethoxyphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 124978838 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | N-[(1S,5S,6S,8R,10R)-5-(2,3-dimethoxyphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]-3-methylbutanamide |
| SMILES | COc1cccc([C@H]2OCC[C@@]34C[C@@H](C[C@H]23)C(C)(C)[C@H]4NC(=O)CC(C)C)c1OC |
| InChI | InChI=1S/C25H37NO4/c1-15(2)12-20(27)26-23-24(3,4)16-13-18-21(30-11-10-25(18,23)14-16)17-8-7-9-19(28-5)22(17)29-6/h7-9,15-16,18,21,23H,10-14H2,1-6H3,(H,26,27)/t16-,18-,21-,23-,25-/m1/s1 |
| InChIKey | LWSOOQOZAKVDAP-UDFHZUOVSA-N |
| XLogP | 4.75 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |