C24H29FN2 — CID 124995569
2-[1-[[(1S)-cyclohex-3-en-1-yl]methyl]piperidin-4-yl]-5-[(3-fluorophenyl)methyl]pyridine (PubChem CID 124995569) has the molecular formula C24H29FN2 and a molecular weight of 364.51 g/mol. Its IUPAC name is 2-[1-[[(1S)-cyclohex-3-en-1-yl]methyl]piperidin-4-yl]-5-[(3-fluorophenyl)methyl]pyridine.
| Compound Name | 2-[1-[[(1S)-cyclohex-3-en-1-yl]methyl]piperidin-4-yl]-5-[(3-fluorophenyl)methyl]pyridine |
|---|---|
| PubChem CID | 124995569 |
| Molecular Formula | C24H29FN2 |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 2-[1-[[(1S)-cyclohex-3-en-1-yl]methyl]piperidin-4-yl]-5-[(3-fluorophenyl)methyl]pyridine |
| SMILES | Fc1cccc(Cc2ccc(C3CCN(C[C@@H]4CC=CCC4)CC3)nc2)c1 |
| InChI | InChI=1S/C24H29FN2/c25-23-8-4-7-20(16-23)15-21-9-10-24(26-17-21)22-11-13-27(14-12-22)18-19-5-2-1-3-6-19/h1-2,4,7-10,16-17,19,22H,3,5-6,11-15,18H2/t19-/m1/s1 |
| InChIKey | QNCMKOPQBNHFCM-LJQANCHMSA-N |
| XLogP | 5.35 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|