C19H24N4O2 — CID 124996699
(3-methoxyphenyl)-[(3R)-3-[[6-(methylamino)pyridazin-3-yl]methyl]piperidin-1-yl]methanone (PubChem CID 124996699) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is (3-methoxyphenyl)-[(3R)-3-[[6-(methylamino)pyridazin-3-yl]methyl]piperidin-1-yl]methanone.
| Compound Name | (3-methoxyphenyl)-[(3R)-3-[[6-(methylamino)pyridazin-3-yl]methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 124996699 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (3-methoxyphenyl)-[(3R)-3-[[6-(methylamino)pyridazin-3-yl]methyl]piperidin-1-yl]methanone |
| SMILES | CNc1ccc(C[C@H]2CCCN(C(=O)c3cccc(OC)c3)C2)nn1 |
| InChI | InChI=1S/C19H24N4O2/c1-20-18-9-8-16(21-22-18)11-14-5-4-10-23(13-14)19(24)15-6-3-7-17(12-15)25-2/h3,6-9,12,14H,4-5,10-11,13H2,1-2H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | QVATUDOBASTYTM-CQSZACIVSA-N |
| XLogP | 2.62 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |