C15H19N3S — CID 125019406
2-methyl-6-[1-(thiophen-2-ylmethyl)piperidin-4-yl]pyrazine (PubChem CID 125019406) has the molecular formula C15H19N3S and a molecular weight of 273.40 g/mol. Its IUPAC name is 2-methyl-6-[1-(thiophen-2-ylmethyl)piperidin-4-yl]pyrazine.
| Compound Name | 2-methyl-6-[1-(thiophen-2-ylmethyl)piperidin-4-yl]pyrazine |
|---|---|
| PubChem CID | 125019406 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-methyl-6-[1-(thiophen-2-ylmethyl)piperidin-4-yl]pyrazine |
| SMILES | Cc1cncc(C2CCN(Cc3cccs3)CC2)n1 |
| InChI | InChI=1S/C15H19N3S/c1-12-9-16-10-15(17-12)13-4-6-18(7-5-13)11-14-3-2-8-19-14/h2-3,8-10,13H,4-7,11H2,1H3 |
| InChIKey | XVUONZWLXNXGGX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |