C30H48O5 — CID 125031945
[(1S,2R,5S,6R,9S,10R,13R,15R)-6,10-dimethyl-5-[(1S)-1-[(2S,3R)-3-[(2R)-3-methylbutan-2-yl]oxiran-2-yl]ethyl]-16,17-dioxapentacyclo[13.2.2.01,9.02,6.010,15]nonadecan-13-yl] acetate (PubChem CID 125031945) has the molecular formula C30H48O5 and a molecular weight of 488.71 g/mol. Its IUPAC name is [(1S,2R,5S,6R,9S,10R,13R,15R)-6,10-dimethyl-5-[(1S)-1-[(2S,3R)-3-[(2R)-3-methylbutan-2-yl]oxiran-2-yl]ethyl]-16,17-dioxapentacyclo[13.2.2.01,9.02,6.010,15]nonadecan-13-yl] acetate.
| Compound Name | [(1S,2R,5S,6R,9S,10R,13R,15R)-6,10-dimethyl-5-[(1S)-1-[(2S,3R)-3-[(2R)-3-methylbutan-2-yl]oxiran-2-yl]ethyl]-16,17-dioxapentacyclo[13.2.2.01,9.02,6.010,15]nonadecan-13-yl] acetate |
|---|---|
| PubChem CID | 125031945 |
| Molecular Formula | C30H48O5 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | [(1S,2R,5S,6R,9S,10R,13R,15R)-6,10-dimethyl-5-[(1S)-1-[(2S,3R)-3-[(2R)-3-methylbutan-2-yl]oxiran-2-yl]ethyl]-16,17-dioxapentacyclo[13.2.2.01,9.02,6.010,15]nonadecan-13-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@]2(C)[C@@H]3CC[C@@]4(C)[C@@H](CC[C@H]4[C@H](C)[C@@H]4O[C@@H]4[C@H](C)C(C)C)[C@@]34CC[C@]2(C1)OO4 |
| InChI | InChI=1S/C30H48O5/c1-17(2)18(3)25-26(33-25)19(4)22-8-9-23-27(22,6)12-11-24-28(7)13-10-21(32-20(5)31)16-29(28)14-15-30(23,24)35-34-29/h17-19,21-26H,8-16H2,1-7H3/t18-,19+,21-,22+,23-,24+,25-,26+,27-,28-,29-,30+/m1/s1 |
| InChIKey | TUUMXOVLVDUNHM-ZRHDOZTOSA-N |
| XLogP | 6.48 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|