C29H41N3O2 — CID 125035128
(1R,12R,13R,14S)-17-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-15,17,19-triazapentacyclo[12.5.2.111,13.01,12.015,19]docosa-11(22),20-diene-16,18-dione (PubChem CID 125035128) has the molecular formula C29H41N3O2 and a molecular weight of 463.67 g/mol. Its IUPAC name is (1R,12R,13R,14S)-17-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-15,17,19-triazapentacyclo[12.5.2.111,13.01,12.015,19]docosa-11(22),20-diene-16,18-dione.
| Compound Name | (1R,12R,13R,14S)-17-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-15,17,19-triazapentacyclo[12.5.2.111,13.01,12.015,19]docosa-11(22),20-diene-16,18-dione |
|---|---|
| PubChem CID | 125035128 |
| Molecular Formula | C29H41N3O2 |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.32 |
| IUPAC Name | (1R,12R,13R,14S)-17-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-15,17,19-triazapentacyclo[12.5.2.111,13.01,12.015,19]docosa-11(22),20-diene-16,18-dione |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@H](n1c(=O)n3n(c1=O)[C@@]14C=C[C@H]3[C@@H]3C=C(CCCCCCCCC1)[C@@H]34)C2 |
| InChI | InChI=1S/C29H41N3O2/c1-27(2)20-12-15-28(27,3)23(18-20)30-25(33)31-22-13-16-29(32(31)26(30)34)14-10-8-6-4-5-7-9-11-19-17-21(22)24(19)29/h13,16-17,20-24H,4-12,14-15,18H2,1-3H3/t20-,21-,22-,23+,24-,28-,29+/m0/s1 |
| InChIKey | NSWGHRXEZCJVSG-MNWOHTBHSA-N |
| XLogP | 5.72 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|