C26H35N3O2 — CID 98311757
(1S,7R,8R,19R)-4-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-2,4,6-triazapentacyclo[8.8.1.02,6.07,17.08,19]nonadeca-9,17-diene-3,5-dione (PubChem CID 98311757) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is (1S,7R,8R,19R)-4-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-2,4,6-triazapentacyclo[8.8.1.02,6.07,17.08,19]nonadeca-9,17-diene-3,5-dione.
| Compound Name | (1S,7R,8R,19R)-4-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-2,4,6-triazapentacyclo[8.8.1.02,6.07,17.08,19]nonadeca-9,17-diene-3,5-dione |
|---|---|
| PubChem CID | 98311757 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | (1S,7R,8R,19R)-4-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-2,4,6-triazapentacyclo[8.8.1.02,6.07,17.08,19]nonadeca-9,17-diene-3,5-dione |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@H](n1c(=O)n3n(c1=O)[C@H]1C4=C[C@H]3[C@H]3C(=C[C@H]31)CCCCCC4)C2 |
| InChI | InChI=1S/C26H35N3O2/c1-25(2)17-10-11-26(25,3)20(14-17)27-23(30)28-19-13-16-9-7-5-4-6-8-15-12-18(21(15)19)22(16)29(28)24(27)31/h12-13,17-22H,4-11,14H2,1-3H3/t17-,18+,19-,20+,21-,22-,26+/m0/s1 |
| InChIKey | FYSSUZWVUGQKLY-IEONNDJISA-N |
| XLogP | 4.76 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|