C28H31N3O2 — CID 98164332
(1R,12R,18R,21S)-15-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-13,15,17-triazahexacyclo[10.5.4.02,11.03,8.013,17.018,21]henicosa-2(11),3,5,7,19-pentaene-14,16-dione (PubChem CID 98164332) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is (1R,12R,18R,21S)-15-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-13,15,17-triazahexacyclo[10.5.4.02,11.03,8.013,17.018,21]henicosa-2(11),3,5,7,19-pentaene-14,16-dione.
| Compound Name | (1R,12R,18R,21S)-15-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-13,15,17-triazahexacyclo[10.5.4.02,11.03,8.013,17.018,21]henicosa-2(11),3,5,7,19-pentaene-14,16-dione |
|---|---|
| PubChem CID | 98164332 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | (1R,12R,18R,21S)-15-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-13,15,17-triazahexacyclo[10.5.4.02,11.03,8.013,17.018,21]henicosa-2(11),3,5,7,19-pentaene-14,16-dione |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H](n1c(=O)n3n(c1=O)[C@H]1C4=C(c5ccccc5CC4)[C@H]3[C@@H]3C=C[C@@H]31)C2 |
| InChI | InChI=1S/C28H31N3O2/c1-27(2)16-12-13-28(27,3)21(14-16)29-25(32)30-23-18-10-11-19(18)24(31(30)26(29)33)22-17-7-5-4-6-15(17)8-9-20(22)23/h4-7,10-11,16,18-19,21,23-24H,8-9,12-14H2,1-3H3/t16-,18+,19-,21-,23-,24-,28+/m1/s1 |
| InChIKey | ATEQWOWTNPGFGE-FGHGCJKFSA-N |
| XLogP | 4.51 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|