C30H35N3O2 — CID 98557975
(1S,10S,11S,17S)-3,6-dimethyl-14-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-12,14,16-triazahexacyclo[8.7.2.211,17.01,10.02,7.012,16]henicosa-2,4,6,18,20-pentaene-13,15-dione (PubChem CID 98557975) has the molecular formula C30H35N3O2 and a molecular weight of 469.63 g/mol. Its IUPAC name is (1S,10S,11S,17S)-3,6-dimethyl-14-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-12,14,16-triazahexacyclo[8.7.2.211,17.01,10.02,7.012,16]henicosa-2,4,6,18,20-pentaene-13,15-dione.
| Compound Name | (1S,10S,11S,17S)-3,6-dimethyl-14-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-12,14,16-triazahexacyclo[8.7.2.211,17.01,10.02,7.012,16]henicosa-2,4,6,18,20-pentaene-13,15-dione |
|---|---|
| PubChem CID | 98557975 |
| Molecular Formula | C30H35N3O2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | (1S,10S,11S,17S)-3,6-dimethyl-14-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-12,14,16-triazahexacyclo[8.7.2.211,17.01,10.02,7.012,16]henicosa-2,4,6,18,20-pentaene-13,15-dione |
| SMILES | Cc1ccc(C)c2c1CC[C@]13C=C[C@]21[C@@H]1C=C[C@@H]3n2c(=O)n([C@@H]3C[C@@H]4CC[C@]3(C)C4(C)C)c(=O)n21 |
| InChI | InChI=1S/C30H35N3O2/c1-17-6-7-18(2)24-20(17)11-13-29-14-15-30(24,29)22-9-8-21(29)32-25(34)31(26(35)33(22)32)23-16-19-10-12-28(23,5)27(19,3)4/h6-9,14-15,19,21-23H,10-13,16H2,1-5H3/t19-,21-,22-,23+,28-,29+,30-/m0/s1 |
| InChIKey | HFTJRLQENRWGBS-XKAPDLRJSA-N |
| XLogP | 4.92 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|